C18H22O3 — CID 170887590
3-(3-ethoxy-4-phenylmethoxyphenyl)propan-1-ol (PubChem CID 170887590) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-(3-ethoxy-4-phenylmethoxyphenyl)propan-1-ol.
| Compound Name | 3-(3-ethoxy-4-phenylmethoxyphenyl)propan-1-ol |
|---|---|
| PubChem CID | 170887590 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 3-(3-ethoxy-4-phenylmethoxyphenyl)propan-1-ol |
| SMILES | CCOc1cc(CCCO)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C18H22O3/c1-2-20-18-13-15(9-6-12-19)10-11-17(18)21-14-16-7-4-3-5-8-16/h3-5,7-8,10-11,13,19H,2,6,9,12,14H2,1H3 |
| InChIKey | PIWTURYAWPZUAH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |