C15H25NO3 — CID 82097746
3-[2-(3,4-diethoxyphenyl)ethylamino]propan-1-ol (PubChem CID 82097746) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is 3-[2-(3,4-diethoxyphenyl)ethylamino]propan-1-ol.
| Compound Name | 3-[2-(3,4-diethoxyphenyl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 82097746 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | 3-[2-(3,4-diethoxyphenyl)ethylamino]propan-1-ol |
| SMILES | CCOc1ccc(CCNCCCO)cc1OCC |
| InChI | InChI=1S/C15H25NO3/c1-3-18-14-7-6-13(12-15(14)19-4-2)8-10-16-9-5-11-17/h6-7,12,16-17H,3-5,8-11H2,1-2H3 |
| InChIKey | KXQNRKRLIRKXJF-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|