C13H20O2 — CID 3995471
1,2-diethoxy-4-propylbenzene (PubChem CID 3995471) has the molecular formula C13H20O2 and a molecular weight of 208.30 g/mol. Its IUPAC name is 1,2-diethoxy-4-propylbenzene.
| Compound Name | 1,2-diethoxy-4-propylbenzene |
|---|---|
| PubChem CID | 3995471 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 1,2-diethoxy-4-propylbenzene |
| SMILES | CCCc1ccc(OCC)c(OCC)c1 |
| InChI | InChI=1S/C13H20O2/c1-4-7-11-8-9-12(14-5-2)13(10-11)15-6-3/h8-10H,4-7H2,1-3H3 |
| InChIKey | MQKBEPIFFKPRRO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |