C11H15ClO2 — CID 2434831
4-(chloromethyl)-1,2-diethoxybenzene (PubChem CID 2434831) has the molecular formula C11H15ClO2 and a molecular weight of 214.69 g/mol. Its IUPAC name is 4-(chloromethyl)-1,2-diethoxybenzene.
| Compound Name | 4-(chloromethyl)-1,2-diethoxybenzene |
|---|---|
| PubChem CID | 2434831 |
| Molecular Formula | C11H15ClO2 |
| Molecular Weight | 214.69 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 4-(chloromethyl)-1,2-diethoxybenzene |
| SMILES | CCOc1ccc(CCl)cc1OCC |
| InChI | InChI=1S/C11H15ClO2/c1-3-13-10-6-5-9(8-12)7-11(10)14-4-2/h5-7H,3-4,8H2,1-2H3 |
| InChIKey | TXBSWQWDLFJQMU-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.69 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|