C11H18NO2+ — CID 7019296
(3,4-diethoxyphenyl)methylazanium (PubChem CID 7019296) has the molecular formula C11H18NO2+ and a molecular weight of 196.27 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)methylazanium.
| Compound Name | (3,4-diethoxyphenyl)methylazanium |
|---|---|
| PubChem CID | 7019296 |
| Molecular Formula | C11H18NO2+ |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | (3,4-diethoxyphenyl)methylazanium |
| SMILES | CCOc1ccc(C[NH3+])cc1OCC |
| InChI | InChI=1S/C11H17NO2/c1-3-13-10-6-5-9(8-12)7-11(10)14-4-2/h5-7H,3-4,8,12H2,1-2H3/p+1 |
| InChIKey | KLDARETZOURFAY-UHFFFAOYSA-O |
| XLogP | 1.23 |
| TPSA | 46.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |