C13H19NO3 — CID 28631811
3-(3,4-diethoxyphenyl)propanamide (PubChem CID 28631811) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is 3-(3,4-diethoxyphenyl)propanamide.
| Compound Name | 3-(3,4-diethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 28631811 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | 3-(3,4-diethoxyphenyl)propanamide |
| SMILES | CCOc1ccc(CCC(N)=O)cc1OCC |
| InChI | InChI=1S/C13H19NO3/c1-3-16-11-7-5-10(6-8-13(14)15)9-12(11)17-4-2/h5,7,9H,3-4,6,8H2,1-2H3,(H2,14,15) |
| InChIKey | IMVWYOCFTZOJIU-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |