C21H26O6 — CID 20985123
3-[3-ethoxy-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]propanoic acid (PubChem CID 20985123) has the molecular formula C21H26O6 and a molecular weight of 374.43 g/mol. Its IUPAC name is 3-[3-ethoxy-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]propanoic acid.
| Compound Name | 3-[3-ethoxy-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 20985123 |
| Molecular Formula | C21H26O6 |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | 3-[3-ethoxy-4-[2-(2-ethoxyphenoxy)ethoxy]phenyl]propanoic acid |
| SMILES | CCOc1ccccc1OCCOc1ccc(CCC(=O)O)cc1OCC |
| InChI | InChI=1S/C21H26O6/c1-3-24-17-7-5-6-8-18(17)26-13-14-27-19-11-9-16(10-12-21(22)23)15-20(19)25-4-2/h5-9,11,15H,3-4,10,12-14H2,1-2H3,(H,22,23) |
| InChIKey | RASMKFBVLDQXRE-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|