C19H20Cl2O5 — CID 20990343
3-[3-chloro-4-[2-(2-chlorophenoxy)ethoxy]-5-ethoxyphenyl]propanoic acid (PubChem CID 20990343) has the molecular formula C19H20Cl2O5 and a molecular weight of 399.27 g/mol. Its IUPAC name is 3-[3-chloro-4-[2-(2-chlorophenoxy)ethoxy]-5-ethoxyphenyl]propanoic acid.
| Compound Name | 3-[3-chloro-4-[2-(2-chlorophenoxy)ethoxy]-5-ethoxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 20990343 |
| Molecular Formula | C19H20Cl2O5 |
| Molecular Weight | 399.27 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 3-[3-chloro-4-[2-(2-chlorophenoxy)ethoxy]-5-ethoxyphenyl]propanoic acid |
| SMILES | CCOc1cc(CCC(=O)O)cc(Cl)c1OCCOc1ccccc1Cl |
| InChI | InChI=1S/C19H20Cl2O5/c1-2-24-17-12-13(7-8-18(22)23)11-15(21)19(17)26-10-9-25-16-6-4-3-5-14(16)20/h3-6,11-12H,2,7-10H2,1H3,(H,22,23) |
| InChIKey | HGZIETGQSDDAFG-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.27 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|