C18H22ClNO4 — CID 20986388
[3-chloro-5-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methanamine (PubChem CID 20986388) has the molecular formula C18H22ClNO4 and a molecular weight of 351.83 g/mol. Its IUPAC name is [3-chloro-5-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methanamine.
| Compound Name | [3-chloro-5-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methanamine |
|---|---|
| PubChem CID | 20986388 |
| Molecular Formula | C18H22ClNO4 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | [3-chloro-5-ethoxy-4-[2-(2-methoxyphenoxy)ethoxy]phenyl]methanamine |
| SMILES | CCOc1cc(CN)cc(Cl)c1OCCOc1ccccc1OC |
| InChI | InChI=1S/C18H22ClNO4/c1-3-22-17-11-13(12-20)10-14(19)18(17)24-9-8-23-16-7-5-4-6-15(16)21-2/h4-7,10-11H,3,8-9,12,20H2,1-2H3 |
| InChIKey | CTDCHOVKNATSIX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|