C17H19Cl2NO3 — CID 20987890
[3-chloro-4-[2-(4-chloro-3-methylphenoxy)ethoxy]-5-methoxyphenyl]methanamine (PubChem CID 20987890) has the molecular formula C17H19Cl2NO3 and a molecular weight of 356.25 g/mol. Its IUPAC name is [3-chloro-4-[2-(4-chloro-3-methylphenoxy)ethoxy]-5-methoxyphenyl]methanamine.
| Compound Name | [3-chloro-4-[2-(4-chloro-3-methylphenoxy)ethoxy]-5-methoxyphenyl]methanamine |
|---|---|
| PubChem CID | 20987890 |
| Molecular Formula | C17H19Cl2NO3 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.07 |
| IUPAC Name | [3-chloro-4-[2-(4-chloro-3-methylphenoxy)ethoxy]-5-methoxyphenyl]methanamine |
| SMILES | COc1cc(CN)cc(Cl)c1OCCOc1ccc(Cl)c(C)c1 |
| InChI | InChI=1S/C17H19Cl2NO3/c1-11-7-13(3-4-14(11)18)22-5-6-23-17-15(19)8-12(10-20)9-16(17)21-2/h3-4,7-9H,5-6,10,20H2,1-2H3 |
| InChIKey | UVMLOHWZKXJPHK-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|