C12H18ClNO4S — CID 63191093
[3-chloro-5-methoxy-4-(3-methylsulfonylpropoxy)phenyl]methanamine (PubChem CID 63191093) has the molecular formula C12H18ClNO4S and a molecular weight of 307.80 g/mol. Its IUPAC name is [3-chloro-5-methoxy-4-(3-methylsulfonylpropoxy)phenyl]methanamine.
| Compound Name | [3-chloro-5-methoxy-4-(3-methylsulfonylpropoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 63191093 |
| Molecular Formula | C12H18ClNO4S |
| Molecular Weight | 307.80 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | [3-chloro-5-methoxy-4-(3-methylsulfonylpropoxy)phenyl]methanamine |
| SMILES | COc1cc(CN)cc(Cl)c1OCCCS(C)(=O)=O |
| InChI | InChI=1S/C12H18ClNO4S/c1-17-11-7-9(8-14)6-10(13)12(11)18-4-3-5-19(2,15)16/h6-7H,3-5,8,14H2,1-2H3 |
| InChIKey | LZHRFUUVUXMULK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.80 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|