C14H23NO4 — CID 104646966
[3,5-dimethoxy-4-(4-methoxybutoxy)phenyl]methanamine (PubChem CID 104646966) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is [3,5-dimethoxy-4-(4-methoxybutoxy)phenyl]methanamine.
| Compound Name | [3,5-dimethoxy-4-(4-methoxybutoxy)phenyl]methanamine |
|---|---|
| PubChem CID | 104646966 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | [3,5-dimethoxy-4-(4-methoxybutoxy)phenyl]methanamine |
| SMILES | COCCCCOc1c(OC)cc(CN)cc1OC |
| InChI | InChI=1S/C14H23NO4/c1-16-6-4-5-7-19-14-12(17-2)8-11(10-15)9-13(14)18-3/h8-9H,4-7,10,15H2,1-3H3 |
| InChIKey | ARURTYZWSGLOPA-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|