C15H23ClO5 — CID 103180740
5-(chloromethyl)-1,3-dimethoxy-2-[2-(3-methoxypropoxy)ethoxy]benzene (PubChem CID 103180740) has the molecular formula C15H23ClO5 and a molecular weight of 318.80 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethoxy-2-[2-(3-methoxypropoxy)ethoxy]benzene.
| Compound Name | 5-(chloromethyl)-1,3-dimethoxy-2-[2-(3-methoxypropoxy)ethoxy]benzene |
|---|---|
| PubChem CID | 103180740 |
| Molecular Formula | C15H23ClO5 |
| Molecular Weight | 318.80 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethoxy-2-[2-(3-methoxypropoxy)ethoxy]benzene |
| SMILES | COCCCOCCOc1c(OC)cc(CCl)cc1OC |
| InChI | InChI=1S/C15H23ClO5/c1-17-5-4-6-20-7-8-21-15-13(18-2)9-12(11-16)10-14(15)19-3/h9-10H,4-8,11H2,1-3H3 |
| InChIKey | WYTBSETVMZQCBD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.80 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|