C11H15ClO4 — CID 65364393
5-(chloromethyl)-1,3-dimethoxy-2-(methoxymethoxy)benzene (PubChem CID 65364393) has the molecular formula C11H15ClO4 and a molecular weight of 246.69 g/mol. Its IUPAC name is 5-(chloromethyl)-1,3-dimethoxy-2-(methoxymethoxy)benzene.
| Compound Name | 5-(chloromethyl)-1,3-dimethoxy-2-(methoxymethoxy)benzene |
|---|---|
| PubChem CID | 65364393 |
| Molecular Formula | C11H15ClO4 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 5-(chloromethyl)-1,3-dimethoxy-2-(methoxymethoxy)benzene |
| SMILES | COCOc1c(OC)cc(CCl)cc1OC |
| InChI | InChI=1S/C11H15ClO4/c1-13-7-16-11-9(14-2)4-8(6-12)5-10(11)15-3/h4-5H,6-7H2,1-3H3 |
| InChIKey | BPRZKIFAIDTARB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|