C16H19ClO3S — CID 43516795
2-[[4-(chloromethyl)-2,6-dimethoxyphenoxy]methyl]-5-ethylthiophene (PubChem CID 43516795) has the molecular formula C16H19ClO3S and a molecular weight of 326.85 g/mol. Its IUPAC name is 2-[[4-(chloromethyl)-2,6-dimethoxyphenoxy]methyl]-5-ethylthiophene.
| Compound Name | 2-[[4-(chloromethyl)-2,6-dimethoxyphenoxy]methyl]-5-ethylthiophene |
|---|---|
| PubChem CID | 43516795 |
| Molecular Formula | C16H19ClO3S |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.07 |
| IUPAC Name | 2-[[4-(chloromethyl)-2,6-dimethoxyphenoxy]methyl]-5-ethylthiophene |
| SMILES | CCc1ccc(COc2c(OC)cc(CCl)cc2OC)s1 |
| InChI | InChI=1S/C16H19ClO3S/c1-4-12-5-6-13(21-12)10-20-16-14(18-2)7-11(9-17)8-15(16)19-3/h5-8H,4,9-10H2,1-3H3 |
| InChIKey | ASQJVHCKYRPOJO-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|