C16H16Cl2O3 — CID 28898530
1-chloro-5-(chloromethyl)-3-methoxy-2-[(4-methoxyphenyl)methoxy]benzene (PubChem CID 28898530) has the molecular formula C16H16Cl2O3 and a molecular weight of 327.21 g/mol. Its IUPAC name is 1-chloro-5-(chloromethyl)-3-methoxy-2-[(4-methoxyphenyl)methoxy]benzene.
| Compound Name | 1-chloro-5-(chloromethyl)-3-methoxy-2-[(4-methoxyphenyl)methoxy]benzene |
|---|---|
| PubChem CID | 28898530 |
| Molecular Formula | C16H16Cl2O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 1-chloro-5-(chloromethyl)-3-methoxy-2-[(4-methoxyphenyl)methoxy]benzene |
| SMILES | COc1ccc(COc2c(Cl)cc(CCl)cc2OC)cc1 |
| InChI | InChI=1S/C16H16Cl2O3/c1-19-13-5-3-11(4-6-13)10-21-16-14(18)7-12(9-17)8-15(16)20-2/h3-8H,9-10H2,1-2H3 |
| InChIKey | IGWCDIRKIGRRLN-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|