C24H26Cl2FNO3 — CID 17293099
N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride (PubChem CID 17293099) has the molecular formula C24H26Cl2FNO3 and a molecular weight of 466.38 g/mol. Its IUPAC name is N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride.
| Compound Name | N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 17293099 |
| Molecular Formula | C24H26Cl2FNO3 |
| Molecular Weight | 466.38 g/mol |
| Exact Mass | 465.13 |
| IUPAC Name | N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]-2-(4-methoxyphenyl)ethanamine;hydrochloride |
| SMILES | COc1ccc(CCNCc2cc(Cl)c(OCc3ccc(F)cc3)c(OC)c2)cc1.Cl |
| InChI | InChI=1S/C24H25ClFNO3.ClH/c1-28-21-9-5-17(6-10-21)11-12-27-15-19-13-22(25)24(23(14-19)29-2)30-16-18-3-7-20(26)8-4-18;/h3-10,13-14,27H,11-12,15-16H2,1-2H3;1H |
| InChIKey | WMLCZGBJOWVTBV-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.38 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|