C19H24Cl2FNO2 — CID 17289491
N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]butan-1-amine;hydrochloride (PubChem CID 17289491) has the molecular formula C19H24Cl2FNO2 and a molecular weight of 388.31 g/mol. Its IUPAC name is N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]butan-1-amine;hydrochloride.
| Compound Name | N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17289491 |
| Molecular Formula | C19H24Cl2FNO2 |
| Molecular Weight | 388.31 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[[3-chloro-4-[(4-fluorophenyl)methoxy]-5-methoxyphenyl]methyl]butan-1-amine;hydrochloride |
| SMILES | CCCCNCc1cc(Cl)c(OCc2ccc(F)cc2)c(OC)c1.Cl |
| InChI | InChI=1S/C19H23ClFNO2.ClH/c1-3-4-9-22-12-15-10-17(20)19(18(11-15)23-2)24-13-14-5-7-16(21)8-6-14;/h5-8,10-11,22H,3-4,9,12-13H2,1-2H3;1H |
| InChIKey | UCYQPFZMTDYLCG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.31 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|