C14H19ClO4 — CID 106929889
5-(chloromethyl)-2-(cyclopropylmethoxymethoxy)-1,3-dimethoxybenzene (PubChem CID 106929889) has the molecular formula C14H19ClO4 and a molecular weight of 286.75 g/mol. Its IUPAC name is 5-(chloromethyl)-2-(cyclopropylmethoxymethoxy)-1,3-dimethoxybenzene.
| Compound Name | 5-(chloromethyl)-2-(cyclopropylmethoxymethoxy)-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 106929889 |
| Molecular Formula | C14H19ClO4 |
| Molecular Weight | 286.75 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-(chloromethyl)-2-(cyclopropylmethoxymethoxy)-1,3-dimethoxybenzene |
| SMILES | COc1cc(CCl)cc(OC)c1OCOCC1CC1 |
| InChI | InChI=1S/C14H19ClO4/c1-16-12-5-11(7-15)6-13(17-2)14(12)19-9-18-8-10-3-4-10/h5-6,10H,3-4,7-9H2,1-2H3 |
| InChIKey | UPBKIJUYPZRAIU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.75 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|