C15H16ClNO3 — CID 43516782
2-[[4-(chloromethyl)-2,6-dimethoxyphenoxy]methyl]pyridine (PubChem CID 43516782) has the molecular formula C15H16ClNO3 and a molecular weight of 293.75 g/mol. Its IUPAC name is 2-[[4-(chloromethyl)-2,6-dimethoxyphenoxy]methyl]pyridine.
| Compound Name | 2-[[4-(chloromethyl)-2,6-dimethoxyphenoxy]methyl]pyridine |
|---|---|
| PubChem CID | 43516782 |
| Molecular Formula | C15H16ClNO3 |
| Molecular Weight | 293.75 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-[[4-(chloromethyl)-2,6-dimethoxyphenoxy]methyl]pyridine |
| SMILES | COc1cc(CCl)cc(OC)c1OCc1ccccn1 |
| InChI | InChI=1S/C15H16ClNO3/c1-18-13-7-11(9-16)8-14(19-2)15(13)20-10-12-5-3-4-6-17-12/h3-8H,9-10H2,1-2H3 |
| InChIKey | NSQFERDUDOMNRN-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|