C14H15BrN2O3 — CID 62700324
2-[[4-(bromomethyl)-2,6-dimethoxyphenoxy]methyl]pyrimidine (PubChem CID 62700324) has the molecular formula C14H15BrN2O3 and a molecular weight of 339.19 g/mol. Its IUPAC name is 2-[[4-(bromomethyl)-2,6-dimethoxyphenoxy]methyl]pyrimidine.
| Compound Name | 2-[[4-(bromomethyl)-2,6-dimethoxyphenoxy]methyl]pyrimidine |
|---|---|
| PubChem CID | 62700324 |
| Molecular Formula | C14H15BrN2O3 |
| Molecular Weight | 339.19 g/mol |
| Exact Mass | 338.03 |
| IUPAC Name | 2-[[4-(bromomethyl)-2,6-dimethoxyphenoxy]methyl]pyrimidine |
| SMILES | COc1cc(CBr)cc(OC)c1OCc1ncccn1 |
| InChI | InChI=1S/C14H15BrN2O3/c1-18-11-6-10(8-15)7-12(19-2)14(11)20-9-13-16-4-3-5-17-13/h3-7H,8-9H2,1-2H3 |
| InChIKey | VDRDMCSORFRARG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.19 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|