C10H13BrO3 — CID 71752807
5-(bromomethyl)-1,2,3-tri((113C)methoxy)benzene (PubChem CID 71752807) has the molecular formula C10H13BrO3 and a molecular weight of 264.09 g/mol. Its IUPAC name is 5-(bromomethyl)-1,2,3-tri((113C)methoxy)benzene.
| Compound Name | 5-(bromomethyl)-1,2,3-tri((113C)methoxy)benzene |
|---|---|
| PubChem CID | 71752807 |
| Molecular Formula | C10H13BrO3 |
| Molecular Weight | 264.09 g/mol |
| Exact Mass | 263.01 |
| IUPAC Name | 5-(bromomethyl)-1,2,3-tri((113C)methoxy)benzene |
| SMILES | [13CH3]Oc1cc(CBr)cc(O[13CH3])c1O[13CH3] |
| InChI | InChI=1S/C10H13BrO3/c1-12-8-4-7(6-11)5-9(13-2)10(8)14-3/h4-5H,6H2,1-3H3/i1+1,2+1,3+1 |
| InChIKey | QEGDRYOJTONTLO-VMIGTVKRSA-N |
| XLogP | 2.61 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.09 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|