C11H18O3Si — CID 175460216
2-(3,4,5-trimethoxyphenyl)ethylsilane (PubChem CID 175460216) has the molecular formula C11H18O3Si and a molecular weight of 226.35 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)ethylsilane.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)ethylsilane |
|---|---|
| PubChem CID | 175460216 |
| Molecular Formula | C11H18O3Si |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)ethylsilane |
| SMILES | COc1cc(CC[SiH3])cc(OC)c1OC |
| InChI | InChI=1S/C11H18O3Si/c1-12-9-6-8(4-5-15)7-10(13-2)11(9)14-3/h6-7H,4-5H2,1-3,15H3 |
| InChIKey | WSSVFLUFBGAFOK-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|