C12H15ClO4 — CID 14650097
3-(3,4,5-trimethoxyphenyl)propanoyl chloride (PubChem CID 14650097) has the molecular formula C12H15ClO4 and a molecular weight of 258.70 g/mol. Its IUPAC name is 3-(3,4,5-trimethoxyphenyl)propanoyl chloride.
| Compound Name | 3-(3,4,5-trimethoxyphenyl)propanoyl chloride |
|---|---|
| PubChem CID | 14650097 |
| Molecular Formula | C12H15ClO4 |
| Molecular Weight | 258.70 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 3-(3,4,5-trimethoxyphenyl)propanoyl chloride |
| SMILES | COc1cc(CCC(=O)Cl)cc(OC)c1OC |
| InChI | InChI=1S/C12H15ClO4/c1-15-9-6-8(4-5-11(13)14)7-10(16-2)12(9)17-3/h6-7H,4-5H2,1-3H3 |
| InChIKey | IBSSQHOLZVHSAW-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.70 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|