C14H17NO4 — CID 602587
3-oxo-5-(3,4,5-trimethoxyphenyl)pentanenitrile (PubChem CID 602587) has the molecular formula C14H17NO4 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-oxo-5-(3,4,5-trimethoxyphenyl)pentanenitrile.
| Compound Name | 3-oxo-5-(3,4,5-trimethoxyphenyl)pentanenitrile |
|---|---|
| PubChem CID | 602587 |
| Molecular Formula | C14H17NO4 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-oxo-5-(3,4,5-trimethoxyphenyl)pentanenitrile |
| SMILES | COc1cc(CCC(=O)CC#N)cc(OC)c1OC |
| InChI | InChI=1S/C14H17NO4/c1-17-12-8-10(4-5-11(16)6-7-15)9-13(18-2)14(12)19-3/h8-9H,4-6H2,1-3H3 |
| InChIKey | LIISCEGVXGXUQU-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 68.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |