C13H20N2O4 — CID 116845027
N-methyl-3-(3,4,5-trimethoxyphenyl)propanehydrazide (PubChem CID 116845027) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is N-methyl-3-(3,4,5-trimethoxyphenyl)propanehydrazide.
| Compound Name | N-methyl-3-(3,4,5-trimethoxyphenyl)propanehydrazide |
|---|---|
| PubChem CID | 116845027 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-methyl-3-(3,4,5-trimethoxyphenyl)propanehydrazide |
| SMILES | COc1cc(CCC(=O)N(C)N)cc(OC)c1OC |
| InChI | InChI=1S/C13H20N2O4/c1-15(14)12(16)6-5-9-7-10(17-2)13(19-4)11(8-9)18-3/h7-8H,5-6,14H2,1-4H3 |
| InChIKey | ZVBNMYPYLAOIKK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|