C13H18O5 — CID 151337220
2-(3,4,5-trimethoxyphenyl)ethyl acetate (PubChem CID 151337220) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)ethyl acetate.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)ethyl acetate |
|---|---|
| PubChem CID | 151337220 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)ethyl acetate |
| SMILES | COc1cc(CCOC(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C13H18O5/c1-9(14)18-6-5-10-7-11(15-2)13(17-4)12(8-10)16-3/h7-8H,5-6H2,1-4H3 |
| InChIKey | OJRMPGZSUJTCRC-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |