C14H21NO5 — CID 11832915
N-methoxy-N-methyl-3-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 11832915) has the molecular formula C14H21NO5 and a molecular weight of 283.32 g/mol. Its IUPAC name is N-methoxy-N-methyl-3-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | N-methoxy-N-methyl-3-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 11832915 |
| Molecular Formula | C14H21NO5 |
| Molecular Weight | 283.32 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | N-methoxy-N-methyl-3-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(CCC(=O)N(C)OC)cc(OC)c1OC |
| InChI | InChI=1S/C14H21NO5/c1-15(20-5)13(16)7-6-10-8-11(17-2)14(19-4)12(9-10)18-3/h8-9H,6-7H2,1-5H3 |
| InChIKey | OWXPQISSSLCRCD-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.32 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|