C11H18NO3+ — CID 6918993
2-(3,4,5-trimethoxyphenyl)ethylazanium (PubChem CID 6918993) has the molecular formula C11H18NO3+ and a molecular weight of 212.27 g/mol. Its IUPAC name is 2-(3,4,5-trimethoxyphenyl)ethylazanium.
| Compound Name | 2-(3,4,5-trimethoxyphenyl)ethylazanium |
|---|---|
| PubChem CID | 6918993 |
| Molecular Formula | C11H18NO3+ |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 2-(3,4,5-trimethoxyphenyl)ethylazanium |
| SMILES | COc1cc(CC[NH3+])cc(OC)c1OC |
| InChI | InChI=1S/C11H17NO3/c1-13-9-6-8(4-5-12)7-10(14-2)11(9)15-3/h6-7H,4-5,12H2,1-3H3/p+1 |
| InChIKey | RHCSKNNOAZULRK-UHFFFAOYSA-O |
| XLogP | 0.50 |
| TPSA | 55.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |