C10H16NO3+ — CID 86311037
2-(3-hydroxy-4,5-dimethoxyphenyl)ethylazanium (PubChem CID 86311037) has the molecular formula C10H16NO3+ and a molecular weight of 198.24 g/mol. Its IUPAC name is 2-(3-hydroxy-4,5-dimethoxyphenyl)ethylazanium.
| Compound Name | 2-(3-hydroxy-4,5-dimethoxyphenyl)ethylazanium |
|---|---|
| PubChem CID | 86311037 |
| Molecular Formula | C10H16NO3+ |
| Molecular Weight | 198.24 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | 2-(3-hydroxy-4,5-dimethoxyphenyl)ethylazanium |
| SMILES | COc1cc(CC[NH3+])cc(O)c1OC |
| InChI | InChI=1S/C10H15NO3/c1-13-9-6-7(3-4-11)5-8(12)10(9)14-2/h5-6,12H,3-4,11H2,1-2H3/p+1 |
| InChIKey | PDKPJPTZKPCMKR-UHFFFAOYSA-O |
| XLogP | 0.19 |
| TPSA | 66.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.24 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |