C18H22O5 — CID 171933718
5-[2-(3,5-dimethoxyphenyl)ethyl]-2,3-dimethoxyphenol (PubChem CID 171933718) has the molecular formula C18H22O5 and a molecular weight of 318.37 g/mol. Its IUPAC name is 5-[2-(3,5-dimethoxyphenyl)ethyl]-2,3-dimethoxyphenol.
| Compound Name | 5-[2-(3,5-dimethoxyphenyl)ethyl]-2,3-dimethoxyphenol |
|---|---|
| PubChem CID | 171933718 |
| Molecular Formula | C18H22O5 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | 5-[2-(3,5-dimethoxyphenyl)ethyl]-2,3-dimethoxyphenol |
| SMILES | COc1cc(CCc2cc(O)c(OC)c(OC)c2)cc(OC)c1 |
| InChI | InChI=1S/C18H22O5/c1-20-14-7-12(8-15(11-14)21-2)5-6-13-9-16(19)18(23-4)17(10-13)22-3/h7-11,19H,5-6H2,1-4H3 |
| InChIKey | MJAPCIQAMUZEAO-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |