C16H18O6 — CID 172870539
5-[2-(3-hydroxy-4,5-dimethoxyphenyl)ethyl]benzene-1,2,3-triol (PubChem CID 172870539) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is 5-[2-(3-hydroxy-4,5-dimethoxyphenyl)ethyl]benzene-1,2,3-triol.
| Compound Name | 5-[2-(3-hydroxy-4,5-dimethoxyphenyl)ethyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 172870539 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | 5-[2-(3-hydroxy-4,5-dimethoxyphenyl)ethyl]benzene-1,2,3-triol |
| SMILES | COc1cc(CCc2cc(O)c(O)c(O)c2)cc(O)c1OC |
| InChI | InChI=1S/C16H18O6/c1-21-14-8-10(7-13(19)16(14)22-2)4-3-9-5-11(17)15(20)12(18)6-9/h5-8,17-20H,3-4H2,1-2H3 |
| InChIKey | DKALAICVMCOSSV-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 99.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|