C15H13F3O3 — CID 67960854
3-methoxy-5-[2-(3,4,5-trifluorophenyl)ethyl]benzene-1,2-diol (PubChem CID 67960854) has the molecular formula C15H13F3O3 and a molecular weight of 298.26 g/mol. Its IUPAC name is 3-methoxy-5-[2-(3,4,5-trifluorophenyl)ethyl]benzene-1,2-diol.
| Compound Name | 3-methoxy-5-[2-(3,4,5-trifluorophenyl)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 67960854 |
| Molecular Formula | C15H13F3O3 |
| Molecular Weight | 298.26 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | 3-methoxy-5-[2-(3,4,5-trifluorophenyl)ethyl]benzene-1,2-diol |
| SMILES | COc1cc(CCc2cc(F)c(F)c(F)c2)cc(O)c1O |
| InChI | InChI=1S/C15H13F3O3/c1-21-13-7-9(6-12(19)15(13)20)3-2-8-4-10(16)14(18)11(17)5-8/h4-7,19-20H,2-3H2,1H3 |
| InChIKey | GYPNJYXHUAMPAR-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|