About 4-(chloromethyl)-2,6-dimethoxyphenol
4-(chloromethyl)-2,6-dimethoxyphenol (PubChem CID 86126298) has the molecular formula C9H11ClO3
and a molecular weight of 202.64 g/mol. Its IUPAC name is 4-(chloromethyl)-2,6-dimethoxyphenol.
Molecular Properties
| Compound Name | 4-(chloromethyl)-2,6-dimethoxyphenol |
| PubChem CID | 86126298 |
| Molecular Formula | C9H11ClO3 |
| Molecular Weight | 202.64 g/mol |
| Exact Mass | 202.04 |
| IUPAC Name | 4-(chloromethyl)-2,6-dimethoxyphenol |
| SMILES | COc1cc(CCl)cc(OC)c1O |
| InChI | InChI=1S/C9H11ClO3/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-4,11H,5H2,1-2H3 |
| InChIKey | DRVKDFGRRNKASG-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.64 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(chloromethyl)-2,6-dimethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(chloromethyl)-2,6-dimethoxyphenol?
The IUPAC name of 4-(chloromethyl)-2,6-dimethoxyphenol (CID 86126298) is 4-(chloromethyl)-2,6-dimethoxyphenol.
What is the SMILES notation for 4-(chloromethyl)-2,6-dimethoxyphenol?
The canonical SMILES for 4-(chloromethyl)-2,6-dimethoxyphenol is COc1cc(CCl)cc(OC)c1O.
What is the InChIKey of 4-(chloromethyl)-2,6-dimethoxyphenol?
The InChIKey is DRVKDFGRRNKASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClO3/c1-12-7-3-6(5-10)4-8(13-2)9(7)11/h3-4,11H,5H2,1-2H3.
What are the key properties of 4-(chloromethyl)-2,6-dimethoxyphenol?
4-(chloromethyl)-2,6-dimethoxyphenol has a molecular weight of 202.64 g/mol, XLogP of 2.15, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(chloromethyl)-2,6-dimethoxyphenol is sourced from PubChem (CID 86126298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).