C10H7ClF6O — CID 134623064
5-(chloromethyl)-1-methoxy-2,3-bis(trifluoromethyl)benzene (PubChem CID 134623064) has the molecular formula C10H7ClF6O and a molecular weight of 292.61 g/mol. Its IUPAC name is 5-(chloromethyl)-1-methoxy-2,3-bis(trifluoromethyl)benzene.
| Compound Name | 5-(chloromethyl)-1-methoxy-2,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 134623064 |
| Molecular Formula | C10H7ClF6O |
| Molecular Weight | 292.61 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 5-(chloromethyl)-1-methoxy-2,3-bis(trifluoromethyl)benzene |
| SMILES | COc1cc(CCl)cc(C(F)(F)F)c1C(F)(F)F |
| InChI | InChI=1S/C10H7ClF6O/c1-18-7-3-5(4-11)2-6(9(12,13)14)8(7)10(15,16)17/h2-3H,4H2,1H3 |
| InChIKey | QWNWBSJBMZHJBO-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.61 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|