C11H12ClF3O — CID 63320761
4-(chloromethyl)-1-propoxy-2-(trifluoromethyl)benzene (PubChem CID 63320761) has the molecular formula C11H12ClF3O and a molecular weight of 252.66 g/mol. Its IUPAC name is 4-(chloromethyl)-1-propoxy-2-(trifluoromethyl)benzene.
| Compound Name | 4-(chloromethyl)-1-propoxy-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 63320761 |
| Molecular Formula | C11H12ClF3O |
| Molecular Weight | 252.66 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 4-(chloromethyl)-1-propoxy-2-(trifluoromethyl)benzene |
| SMILES | CCCOc1ccc(CCl)cc1C(F)(F)F |
| InChI | InChI=1S/C11H12ClF3O/c1-2-5-16-10-4-3-8(7-12)6-9(10)11(13,14)15/h3-4,6H,2,5,7H2,1H3 |
| InChIKey | XQDYQGCWHGSNMN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.66 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|