C15H22F3NO — CID 63319928
N-[[4-butoxy-3-(trifluoromethyl)phenyl]methyl]propan-2-amine (PubChem CID 63319928) has the molecular formula C15H22F3NO and a molecular weight of 289.34 g/mol. Its IUPAC name is N-[[4-butoxy-3-(trifluoromethyl)phenyl]methyl]propan-2-amine.
| Compound Name | N-[[4-butoxy-3-(trifluoromethyl)phenyl]methyl]propan-2-amine |
|---|---|
| PubChem CID | 63319928 |
| Molecular Formula | C15H22F3NO |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | N-[[4-butoxy-3-(trifluoromethyl)phenyl]methyl]propan-2-amine |
| SMILES | CCCCOc1ccc(CNC(C)C)cc1C(F)(F)F |
| InChI | InChI=1S/C15H22F3NO/c1-4-5-8-20-14-7-6-12(10-19-11(2)3)9-13(14)15(16,17)18/h6-7,9,11,19H,4-5,8,10H2,1-3H3 |
| InChIKey | RAQMFHDFAHANKB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|