C18H28F3NO2 — CID 143869125
3-[[4-heptoxy-3-(trifluoromethyl)phenyl]methylamino]propan-1-ol (PubChem CID 143869125) has the molecular formula C18H28F3NO2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 3-[[4-heptoxy-3-(trifluoromethyl)phenyl]methylamino]propan-1-ol.
| Compound Name | 3-[[4-heptoxy-3-(trifluoromethyl)phenyl]methylamino]propan-1-ol |
|---|---|
| PubChem CID | 143869125 |
| Molecular Formula | C18H28F3NO2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 3-[[4-heptoxy-3-(trifluoromethyl)phenyl]methylamino]propan-1-ol |
| SMILES | CCCCCCCOc1ccc(CNCCCO)cc1C(F)(F)F |
| InChI | InChI=1S/C18H28F3NO2/c1-2-3-4-5-6-12-24-17-9-8-15(14-22-10-7-11-23)13-16(17)18(19,20)21/h8-9,13,22-23H,2-7,10-12,14H2,1H3 |
| InChIKey | YDLCPJJGVXPRLP-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|