C14H18ClF3O2 — CID 115942949
4-(chloromethyl)-1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-2-(trifluoromethyl)benzene (PubChem CID 115942949) has the molecular formula C14H18ClF3O2 and a molecular weight of 310.74 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-2-(trifluoromethyl)benzene.
| Compound Name | 4-(chloromethyl)-1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 115942949 |
| Molecular Formula | C14H18ClF3O2 |
| Molecular Weight | 310.74 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 4-(chloromethyl)-1-[2-[(2-methylpropan-2-yl)oxy]ethoxy]-2-(trifluoromethyl)benzene |
| SMILES | CC(C)(C)OCCOc1ccc(CCl)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18ClF3O2/c1-13(2,3)20-7-6-19-12-5-4-10(9-15)8-11(12)14(16,17)18/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | UXZSFNWHIBRKAV-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.74 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|