C20H21Cl2F3O — CID 66596590
4-butyl-1-[3-(3,4-dichlorophenyl)propoxy]-2-(trifluoromethyl)benzene (PubChem CID 66596590) has the molecular formula C20H21Cl2F3O and a molecular weight of 405.29 g/mol. Its IUPAC name is 4-butyl-1-[3-(3,4-dichlorophenyl)propoxy]-2-(trifluoromethyl)benzene.
| Compound Name | 4-butyl-1-[3-(3,4-dichlorophenyl)propoxy]-2-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 66596590 |
| Molecular Formula | C20H21Cl2F3O |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.09 |
| IUPAC Name | 4-butyl-1-[3-(3,4-dichlorophenyl)propoxy]-2-(trifluoromethyl)benzene |
| SMILES | CCCCc1ccc(OCCCc2ccc(Cl)c(Cl)c2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H21Cl2F3O/c1-2-3-5-14-8-10-19(16(12-14)20(23,24)25)26-11-4-6-15-7-9-17(21)18(22)13-15/h7-10,12-13H,2-6,11H2,1H3 |
| InChIKey | OZUJSNKPPSCMOB-UHFFFAOYSA-N |
| XLogP | 7.37 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|