C28H36Cl2F3NO5 — CID 59407830
tert-butyl N-[4-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-1-(methoxymethoxy)-2-methylbutan-2-yl]carbamate (PubChem CID 59407830) has the molecular formula C28H36Cl2F3NO5 and a molecular weight of 594.50 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-1-(methoxymethoxy)-2-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-1-(methoxymethoxy)-2-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 59407830 |
| Molecular Formula | C28H36Cl2F3NO5 |
| Molecular Weight | 594.50 g/mol |
| Exact Mass | 593.19 |
| IUPAC Name | tert-butyl N-[4-[4-[3-(3,4-dichlorophenyl)propoxy]-3-(trifluoromethyl)phenyl]-1-(methoxymethoxy)-2-methylbutan-2-yl]carbamate |
| SMILES | COCOCC(C)(CCc1ccc(OCCCc2ccc(Cl)c(Cl)c2)c(C(F)(F)F)c1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H36Cl2F3NO5/c1-26(2,3)39-25(35)34-27(4,17-37-18-36-5)13-12-20-9-11-24(21(15-20)28(31,32)33)38-14-6-7-19-8-10-22(29)23(30)16-19/h8-11,15-16H,6-7,12-14,17-18H2,1-5H3,(H,34,35) |
| InChIKey | TXKHWWOKWQASPV-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.50 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|