C21H30F5NO4 — CID 86606738
tert-butyl N-[(2R)-1-hydroxy-2-methyl-4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]butan-2-yl]carbamate (PubChem CID 86606738) has the molecular formula C21H30F5NO4 and a molecular weight of 455.46 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-hydroxy-2-methyl-4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]butan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-hydroxy-2-methyl-4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]butan-2-yl]carbamate |
|---|---|
| PubChem CID | 86606738 |
| Molecular Formula | C21H30F5NO4 |
| Molecular Weight | 455.46 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | tert-butyl N-[(2R)-1-hydroxy-2-methyl-4-[4-(4,4,5,5,5-pentafluoropentoxy)phenyl]butan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@](C)(CO)CCc1ccc(OCCCC(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H30F5NO4/c1-18(2,3)31-17(29)27-19(4,14-28)12-10-15-6-8-16(9-7-15)30-13-5-11-20(22,23)21(24,25)26/h6-9,28H,5,10-14H2,1-4H3,(H,27,29)/t19-/m1/s1 |
| InChIKey | UVPLIDRCNRJGFV-LJQANCHMSA-N |
| XLogP | 5.25 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.46 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|