C16H25FN2O2 — CID 84730989
tert-butyl N-[1-amino-4-(4-fluorophenyl)-2-methylbutan-2-yl]carbamate (PubChem CID 84730989) has the molecular formula C16H25FN2O2 and a molecular weight of 296.39 g/mol. Its IUPAC name is tert-butyl N-[1-amino-4-(4-fluorophenyl)-2-methylbutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-amino-4-(4-fluorophenyl)-2-methylbutan-2-yl]carbamate |
|---|---|
| PubChem CID | 84730989 |
| Molecular Formula | C16H25FN2O2 |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | tert-butyl N-[1-amino-4-(4-fluorophenyl)-2-methylbutan-2-yl]carbamate |
| SMILES | CC(CN)(CCc1ccc(F)cc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25FN2O2/c1-15(2,3)21-14(20)19-16(4,11-18)10-9-12-5-7-13(17)8-6-12/h5-8H,9-11,18H2,1-4H3,(H,19,20) |
| InChIKey | GEECKBYADOIGQO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |