C15H21NO5 — CID 22284629
2-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid (PubChem CID 22284629) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is 2-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid.
| Compound Name | 2-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 22284629 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | 2-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(O)(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H21NO5/c1-14(2,3)21-13(19)16-15(20,12(17)18)10-9-11-7-5-4-6-8-11/h4-8,20H,9-10H2,1-3H3,(H,16,19)(H,17,18) |
| InChIKey | CEHGENUPNMWNFL-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|