C13H17NO5 — CID 19604478
2-(ethoxycarbonylamino)-2-hydroxy-4-phenylbutanoic acid (PubChem CID 19604478) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is 2-(ethoxycarbonylamino)-2-hydroxy-4-phenylbutanoic acid.
| Compound Name | 2-(ethoxycarbonylamino)-2-hydroxy-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 19604478 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | 2-(ethoxycarbonylamino)-2-hydroxy-4-phenylbutanoic acid |
| SMILES | CCOC(=O)NC(O)(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H17NO5/c1-2-19-12(17)14-13(18,11(15)16)9-8-10-6-4-3-5-7-10/h3-7,18H,2,8-9H2,1H3,(H,14,17)(H,15,16) |
| InChIKey | ASKIVPZZRRPXCJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|