C20H26N2O3 — CID 150783434
ethyl N-[[4-[1-hydroxy-1-(methylamino)-3-phenylpropyl]phenyl]methyl]carbamate (PubChem CID 150783434) has the molecular formula C20H26N2O3 and a molecular weight of 342.44 g/mol. Its IUPAC name is ethyl N-[[4-[1-hydroxy-1-(methylamino)-3-phenylpropyl]phenyl]methyl]carbamate.
| Compound Name | ethyl N-[[4-[1-hydroxy-1-(methylamino)-3-phenylpropyl]phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 150783434 |
| Molecular Formula | C20H26N2O3 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | ethyl N-[[4-[1-hydroxy-1-(methylamino)-3-phenylpropyl]phenyl]methyl]carbamate |
| SMILES | CCOC(=O)NCc1ccc(C(O)(CCc2ccccc2)NC)cc1 |
| InChI | InChI=1S/C20H26N2O3/c1-3-25-19(23)22-15-17-9-11-18(12-10-17)20(24,21-2)14-13-16-7-5-4-6-8-16/h4-12,21,24H,3,13-15H2,1-2H3,(H,22,23) |
| InChIKey | KCIYZPXIUREAHV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|