C24H30N2O6 — CID 67735094
2-hydroxy-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-4-phenylbutanoic acid (PubChem CID 67735094) has the molecular formula C24H30N2O6 and a molecular weight of 442.51 g/mol. Its IUPAC name is 2-hydroxy-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-4-phenylbutanoic acid.
| Compound Name | 2-hydroxy-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-4-phenylbutanoic acid |
|---|---|
| PubChem CID | 67735094 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-hydroxy-2-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-4-phenylbutanoic acid |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)NC(O)(CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C24H30N2O6/c1-17(2)15-20(25-23(30)32-16-19-11-7-4-8-12-19)21(27)26-24(31,22(28)29)14-13-18-9-5-3-6-10-18/h3-12,17,20,31H,13-16H2,1-2H3,(H,25,30)(H,26,27)(H,28,29)/t20-,24?/m0/s1 |
| InChIKey | RALJBDWGJUVZHC-QHELBMECSA-N |
| XLogP | 2.85 |
| TPSA | 124.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|