C19H29NO4S — CID 175042835
6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-phenylethyl)hexanethioic S-acid (PubChem CID 175042835) has the molecular formula C19H29NO4S and a molecular weight of 367.51 g/mol. Its IUPAC name is 6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-phenylethyl)hexanethioic S-acid.
| Compound Name | 6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-phenylethyl)hexanethioic S-acid |
|---|---|
| PubChem CID | 175042835 |
| Molecular Formula | C19H29NO4S |
| Molecular Weight | 367.51 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | 6-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-(2-phenylethyl)hexanethioic S-acid |
| SMILES | CC(C)(C)OC(=O)NC(CCCCO)(CCc1ccccc1)C(=O)S |
| InChI | InChI=1S/C19H29NO4S/c1-18(2,3)24-17(23)20-19(16(22)25,12-7-8-14-21)13-11-15-9-5-4-6-10-15/h4-6,9-10,21H,7-8,11-14H2,1-3H3,(H,20,23)(H,22,25) |
| InChIKey | GSEAHVSCAGCKDE-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|