C18H25F3N2O5 — CID 162772727
tert-butyl N-[[(2R)-5-hydroxy-2-phenylmethoxy-2-(trifluoromethyl)pentanoyl]amino]carbamate (PubChem CID 162772727) has the molecular formula C18H25F3N2O5 and a molecular weight of 406.40 g/mol. Its IUPAC name is tert-butyl N-[[(2R)-5-hydroxy-2-phenylmethoxy-2-(trifluoromethyl)pentanoyl]amino]carbamate.
| Compound Name | tert-butyl N-[[(2R)-5-hydroxy-2-phenylmethoxy-2-(trifluoromethyl)pentanoyl]amino]carbamate |
|---|---|
| PubChem CID | 162772727 |
| Molecular Formula | C18H25F3N2O5 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | tert-butyl N-[[(2R)-5-hydroxy-2-phenylmethoxy-2-(trifluoromethyl)pentanoyl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC(=O)[C@@](CCCO)(OCc1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C18H25F3N2O5/c1-16(2,3)28-15(26)23-22-14(25)17(10-7-11-24,18(19,20)21)27-12-13-8-5-4-6-9-13/h4-6,8-9,24H,7,10-12H2,1-3H3,(H,22,25)(H,23,26)/t17-/m1/s1 |
| InChIKey | OFFYTZNECCLMDV-QGZVFWFLSA-N |
| XLogP | 2.83 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|