C17H25NO5 — CID 175248358
3-O-benzyl 1-O-tert-butyl 2-amino-2-(3-hydroxypropyl)propanedioate (PubChem CID 175248358) has the molecular formula C17H25NO5 and a molecular weight of 323.39 g/mol. Its IUPAC name is 3-O-benzyl 1-O-tert-butyl 2-amino-2-(3-hydroxypropyl)propanedioate.
| Compound Name | 3-O-benzyl 1-O-tert-butyl 2-amino-2-(3-hydroxypropyl)propanedioate |
|---|---|
| PubChem CID | 175248358 |
| Molecular Formula | C17H25NO5 |
| Molecular Weight | 323.39 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 3-O-benzyl 1-O-tert-butyl 2-amino-2-(3-hydroxypropyl)propanedioate |
| SMILES | CC(C)(C)OC(=O)C(N)(CCCO)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H25NO5/c1-16(2,3)23-15(21)17(18,10-7-11-19)14(20)22-12-13-8-5-4-6-9-13/h4-6,8-9,19H,7,10-12,18H2,1-3H3 |
| InChIKey | GFIIFOVKHLWIPF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 98.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|